C17H15F2N3 — CID 112719016
1-benzyl-4-[2-(3,4-difluorophenyl)ethyl]triazole (PubChem CID 112719016) has the molecular formula C17H15F2N3 and a molecular weight of 299.32 g/mol. Its IUPAC name is 1-benzyl-4-[2-(3,4-difluorophenyl)ethyl]triazole.
| Compound Name | 1-benzyl-4-[2-(3,4-difluorophenyl)ethyl]triazole |
|---|---|
| PubChem CID | 112719016 |
| Molecular Formula | C17H15F2N3 |
| Molecular Weight | 299.32 g/mol |
| Exact Mass | 299.12 |
| IUPAC Name | 1-benzyl-4-[2-(3,4-difluorophenyl)ethyl]triazole |
| SMILES | Fc1ccc(CCc2cn(Cc3ccccc3)nn2)cc1F |
| InChI | InChI=1S/C17H15F2N3/c18-16-9-7-13(10-17(16)19)6-8-15-12-22(21-20-15)11-14-4-2-1-3-5-14/h1-5,7,9-10,12H,6,8,11H2 |
| InChIKey | KEELKUNDHNIQME-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.32 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |