C11H10BrF2N3 — CID 82930440
4-(2-bromoethyl)-1-[(3,4-difluorophenyl)methyl]triazole (PubChem CID 82930440) has the molecular formula C11H10BrF2N3 and a molecular weight of 302.12 g/mol. Its IUPAC name is 4-(2-bromoethyl)-1-[(3,4-difluorophenyl)methyl]triazole.
| Compound Name | 4-(2-bromoethyl)-1-[(3,4-difluorophenyl)methyl]triazole |
|---|---|
| PubChem CID | 82930440 |
| Molecular Formula | C11H10BrF2N3 |
| Molecular Weight | 302.12 g/mol |
| Exact Mass | 301.00 |
| IUPAC Name | 4-(2-bromoethyl)-1-[(3,4-difluorophenyl)methyl]triazole |
| SMILES | Fc1ccc(Cn2cc(CCBr)nn2)cc1F |
| InChI | InChI=1S/C11H10BrF2N3/c12-4-3-9-7-17(16-15-9)6-8-1-2-10(13)11(14)5-8/h1-2,5,7H,3-4,6H2 |
| InChIKey | NNZWDSGLCNQMGH-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.12 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|