C12H14FN3O2 — CID 62402234
2-[1-[(3-fluoro-4-methoxyphenyl)methyl]triazol-4-yl]ethanol (PubChem CID 62402234) has the molecular formula C12H14FN3O2 and a molecular weight of 251.26 g/mol. Its IUPAC name is 2-[1-[(3-fluoro-4-methoxyphenyl)methyl]triazol-4-yl]ethanol.
| Compound Name | 2-[1-[(3-fluoro-4-methoxyphenyl)methyl]triazol-4-yl]ethanol |
|---|---|
| PubChem CID | 62402234 |
| Molecular Formula | C12H14FN3O2 |
| Molecular Weight | 251.26 g/mol |
| Exact Mass | 251.11 |
| IUPAC Name | 2-[1-[(3-fluoro-4-methoxyphenyl)methyl]triazol-4-yl]ethanol |
| SMILES | COc1ccc(Cn2cc(CCO)nn2)cc1F |
| InChI | InChI=1S/C12H14FN3O2/c1-18-12-3-2-9(6-11(12)13)7-16-8-10(4-5-17)14-15-16/h2-3,6,8,17H,4-5,7H2,1H3 |
| InChIKey | RUNJOQSATXFEOM-UHFFFAOYSA-N |
| XLogP | 1.01 |
| TPSA | 60.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.26 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |