C11H11F2N3O — CID 55066656
2-[1-[(2,3-difluorophenyl)methyl]triazol-4-yl]ethanol (PubChem CID 55066656) has the molecular formula C11H11F2N3O and a molecular weight of 239.22 g/mol. Its IUPAC name is 2-[1-[(2,3-difluorophenyl)methyl]triazol-4-yl]ethanol.
| Compound Name | 2-[1-[(2,3-difluorophenyl)methyl]triazol-4-yl]ethanol |
|---|---|
| PubChem CID | 55066656 |
| Molecular Formula | C11H11F2N3O |
| Molecular Weight | 239.22 g/mol |
| Exact Mass | 239.09 |
| IUPAC Name | 2-[1-[(2,3-difluorophenyl)methyl]triazol-4-yl]ethanol |
| SMILES | OCCc1cn(Cc2cccc(F)c2F)nn1 |
| InChI | InChI=1S/C11H11F2N3O/c12-10-3-1-2-8(11(10)13)6-16-7-9(4-5-17)14-15-16/h1-3,7,17H,4-6H2 |
| InChIKey | IKLUCCSSOWFFBP-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.22 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |