C11H10BrF2N3 — CID 81448341
4-(1-bromoethyl)-1-[(2,3-difluorophenyl)methyl]triazole (PubChem CID 81448341) has the molecular formula C11H10BrF2N3 and a molecular weight of 302.12 g/mol. Its IUPAC name is 4-(1-bromoethyl)-1-[(2,3-difluorophenyl)methyl]triazole.
| Compound Name | 4-(1-bromoethyl)-1-[(2,3-difluorophenyl)methyl]triazole |
|---|---|
| PubChem CID | 81448341 |
| Molecular Formula | C11H10BrF2N3 |
| Molecular Weight | 302.12 g/mol |
| Exact Mass | 301.00 |
| IUPAC Name | 4-(1-bromoethyl)-1-[(2,3-difluorophenyl)methyl]triazole |
| SMILES | CC(Br)c1cn(Cc2cccc(F)c2F)nn1 |
| InChI | InChI=1S/C11H10BrF2N3/c1-7(12)10-6-17(16-15-10)5-8-3-2-4-9(13)11(8)14/h2-4,6-7H,5H2,1H3 |
| InChIKey | GOHSUPGCFFSPAL-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.12 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|