C13H16ClFN4 — CID 106229222
1-[1-[(2-chloro-3-fluorophenyl)methyl]triazol-4-yl]butan-1-amine (PubChem CID 106229222) has the molecular formula C13H16ClFN4 and a molecular weight of 282.75 g/mol. Its IUPAC name is 1-[1-[(2-chloro-3-fluorophenyl)methyl]triazol-4-yl]butan-1-amine.
| Compound Name | 1-[1-[(2-chloro-3-fluorophenyl)methyl]triazol-4-yl]butan-1-amine |
|---|---|
| PubChem CID | 106229222 |
| Molecular Formula | C13H16ClFN4 |
| Molecular Weight | 282.75 g/mol |
| Exact Mass | 282.10 |
| IUPAC Name | 1-[1-[(2-chloro-3-fluorophenyl)methyl]triazol-4-yl]butan-1-amine |
| SMILES | CCCC(N)c1cn(Cc2cccc(F)c2Cl)nn1 |
| InChI | InChI=1S/C13H16ClFN4/c1-2-4-11(16)12-8-19(18-17-12)7-9-5-3-6-10(15)13(9)14/h3,5-6,8,11H,2,4,7,16H2,1H3 |
| InChIKey | WHINNPCYUNMPJV-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.75 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |