C15H22N4O2 — CID 106228693
1-[1-[(2,5-dimethoxyphenyl)methyl]triazol-4-yl]butan-1-amine (PubChem CID 106228693) has the molecular formula C15H22N4O2 and a molecular weight of 290.37 g/mol. Its IUPAC name is 1-[1-[(2,5-dimethoxyphenyl)methyl]triazol-4-yl]butan-1-amine.
| Compound Name | 1-[1-[(2,5-dimethoxyphenyl)methyl]triazol-4-yl]butan-1-amine |
|---|---|
| PubChem CID | 106228693 |
| Molecular Formula | C15H22N4O2 |
| Molecular Weight | 290.37 g/mol |
| Exact Mass | 290.17 |
| IUPAC Name | 1-[1-[(2,5-dimethoxyphenyl)methyl]triazol-4-yl]butan-1-amine |
| SMILES | CCCC(N)c1cn(Cc2cc(OC)ccc2OC)nn1 |
| InChI | InChI=1S/C15H22N4O2/c1-4-5-13(16)14-10-19(18-17-14)9-11-8-12(20-2)6-7-15(11)21-3/h6-8,10,13H,4-5,9,16H2,1-3H3 |
| InChIKey | OKZOFDUNRWUCJE-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 75.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.37 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |