C13H16ClN3O2 — CID 81449512
4-(1-chloroethyl)-1-[(2,5-dimethoxyphenyl)methyl]triazole (PubChem CID 81449512) has the molecular formula C13H16ClN3O2 and a molecular weight of 281.74 g/mol. Its IUPAC name is 4-(1-chloroethyl)-1-[(2,5-dimethoxyphenyl)methyl]triazole.
| Compound Name | 4-(1-chloroethyl)-1-[(2,5-dimethoxyphenyl)methyl]triazole |
|---|---|
| PubChem CID | 81449512 |
| Molecular Formula | C13H16ClN3O2 |
| Molecular Weight | 281.74 g/mol |
| Exact Mass | 281.09 |
| IUPAC Name | 4-(1-chloroethyl)-1-[(2,5-dimethoxyphenyl)methyl]triazole |
| SMILES | COc1ccc(OC)c(Cn2cc(C(C)Cl)nn2)c1 |
| InChI | InChI=1S/C13H16ClN3O2/c1-9(14)12-8-17(16-15-12)7-10-6-11(18-2)4-5-13(10)19-3/h4-6,8-9H,7H2,1-3H3 |
| InChIKey | LMFWHGCVBAVHHV-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 49.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.74 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|