C11H13FN4O — CID 55029615
[1-[(5-fluoro-2-methoxyphenyl)methyl]triazol-4-yl]methanamine (PubChem CID 55029615) has the molecular formula C11H13FN4O and a molecular weight of 236.25 g/mol. Its IUPAC name is [1-[(5-fluoro-2-methoxyphenyl)methyl]triazol-4-yl]methanamine.
| Compound Name | [1-[(5-fluoro-2-methoxyphenyl)methyl]triazol-4-yl]methanamine |
|---|---|
| PubChem CID | 55029615 |
| Molecular Formula | C11H13FN4O |
| Molecular Weight | 236.25 g/mol |
| Exact Mass | 236.11 |
| IUPAC Name | [1-[(5-fluoro-2-methoxyphenyl)methyl]triazol-4-yl]methanamine |
| SMILES | COc1ccc(F)cc1Cn1cc(CN)nn1 |
| InChI | InChI=1S/C11H13FN4O/c1-17-11-3-2-9(12)4-8(11)6-16-7-10(5-13)14-15-16/h2-4,7H,5-6,13H2,1H3 |
| InChIKey | GQIDPOOUNUSYTH-UHFFFAOYSA-N |
| XLogP | 0.93 |
| TPSA | 65.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.25 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |