C10H9F2N3O — CID 62399428
[1-[(2,5-difluorophenyl)methyl]triazol-4-yl]methanol (PubChem CID 62399428) has the molecular formula C10H9F2N3O and a molecular weight of 225.20 g/mol. Its IUPAC name is [1-[(2,5-difluorophenyl)methyl]triazol-4-yl]methanol.
| Compound Name | [1-[(2,5-difluorophenyl)methyl]triazol-4-yl]methanol |
|---|---|
| PubChem CID | 62399428 |
| Molecular Formula | C10H9F2N3O |
| Molecular Weight | 225.20 g/mol |
| Exact Mass | 225.07 |
| IUPAC Name | [1-[(2,5-difluorophenyl)methyl]triazol-4-yl]methanol |
| SMILES | OCc1cn(Cc2cc(F)ccc2F)nn1 |
| InChI | InChI=1S/C10H9F2N3O/c11-8-1-2-10(12)7(3-8)4-15-5-9(6-16)13-14-15/h1-3,5,16H,4,6H2 |
| InChIKey | CPXCFPVHWMSVCC-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.20 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |