C15H21BrN4O — CID 66191907
N-[[1-[(5-bromo-2-methoxyphenyl)methyl]triazol-4-yl]methyl]-2-methylpropan-1-amine (PubChem CID 66191907) has the molecular formula C15H21BrN4O and a molecular weight of 353.26 g/mol. Its IUPAC name is N-[[1-[(5-bromo-2-methoxyphenyl)methyl]triazol-4-yl]methyl]-2-methylpropan-1-amine.
| Compound Name | N-[[1-[(5-bromo-2-methoxyphenyl)methyl]triazol-4-yl]methyl]-2-methylpropan-1-amine |
|---|---|
| PubChem CID | 66191907 |
| Molecular Formula | C15H21BrN4O |
| Molecular Weight | 353.26 g/mol |
| Exact Mass | 352.09 |
| IUPAC Name | N-[[1-[(5-bromo-2-methoxyphenyl)methyl]triazol-4-yl]methyl]-2-methylpropan-1-amine |
| SMILES | COc1ccc(Br)cc1Cn1cc(CNCC(C)C)nn1 |
| InChI | InChI=1S/C15H21BrN4O/c1-11(2)7-17-8-14-10-20(19-18-14)9-12-6-13(16)4-5-15(12)21-3/h4-6,10-11,17H,7-9H2,1-3H3 |
| InChIKey | XXYFHUCIBOLCDH-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 51.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.26 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |