C14H20N4O2 — CID 71914265
5-tert-butyl-1-[(2,5-dimethoxyphenyl)methyl]tetrazole (PubChem CID 71914265) has the molecular formula C14H20N4O2 and a molecular weight of 276.34 g/mol. Its IUPAC name is 5-tert-butyl-1-[(2,5-dimethoxyphenyl)methyl]tetrazole.
| Compound Name | 5-tert-butyl-1-[(2,5-dimethoxyphenyl)methyl]tetrazole |
|---|---|
| PubChem CID | 71914265 |
| Molecular Formula | C14H20N4O2 |
| Molecular Weight | 276.34 g/mol |
| Exact Mass | 276.16 |
| IUPAC Name | 5-tert-butyl-1-[(2,5-dimethoxyphenyl)methyl]tetrazole |
| SMILES | COc1ccc(OC)c(Cn2nnnc2C(C)(C)C)c1 |
| InChI | InChI=1S/C14H20N4O2/c1-14(2,3)13-15-16-17-18(13)9-10-8-11(19-4)6-7-12(10)20-5/h6-8H,9H2,1-5H3 |
| InChIKey | FHWKFVLZLZOKMJ-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 62.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.34 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |