C13H17FN4 — CID 106227069
1-[1-(3-fluoro-2-methylphenyl)triazol-4-yl]butan-1-amine (PubChem CID 106227069) has the molecular formula C13H17FN4 and a molecular weight of 248.30 g/mol. Its IUPAC name is 1-[1-(3-fluoro-2-methylphenyl)triazol-4-yl]butan-1-amine.
| Compound Name | 1-[1-(3-fluoro-2-methylphenyl)triazol-4-yl]butan-1-amine |
|---|---|
| PubChem CID | 106227069 |
| Molecular Formula | C13H17FN4 |
| Molecular Weight | 248.30 g/mol |
| Exact Mass | 248.14 |
| IUPAC Name | 1-[1-(3-fluoro-2-methylphenyl)triazol-4-yl]butan-1-amine |
| SMILES | CCCC(N)c1cn(-c2cccc(F)c2C)nn1 |
| InChI | InChI=1S/C13H17FN4/c1-3-5-11(15)12-8-18(17-16-12)13-7-4-6-10(14)9(13)2/h4,6-8,11H,3,5,15H2,1-2H3 |
| InChIKey | BGGWZQDHQVSIDQ-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.30 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |