C12H15IN4 — CID 114160881
1-[1-(3-iodophenyl)triazol-4-yl]butan-1-amine (PubChem CID 114160881) has the molecular formula C12H15IN4 and a molecular weight of 342.18 g/mol. Its IUPAC name is 1-[1-(3-iodophenyl)triazol-4-yl]butan-1-amine.
| Compound Name | 1-[1-(3-iodophenyl)triazol-4-yl]butan-1-amine |
|---|---|
| PubChem CID | 114160881 |
| Molecular Formula | C12H15IN4 |
| Molecular Weight | 342.18 g/mol |
| Exact Mass | 342.03 |
| IUPAC Name | 1-[1-(3-iodophenyl)triazol-4-yl]butan-1-amine |
| SMILES | CCCC(N)c1cn(-c2cccc(I)c2)nn1 |
| InChI | InChI=1S/C12H15IN4/c1-2-4-11(14)12-8-17(16-15-12)10-6-3-5-9(13)7-10/h3,5-8,11H,2,4,14H2,1H3 |
| InChIKey | VCMACEKARVKAGR-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.18 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|