C12H11BrFN3O2 — CID 107460898
3-[1-[(3-bromo-4-fluorophenyl)methyl]triazol-4-yl]propanoic acid (PubChem CID 107460898) has the molecular formula C12H11BrFN3O2 and a molecular weight of 328.14 g/mol. Its IUPAC name is 3-[1-[(3-bromo-4-fluorophenyl)methyl]triazol-4-yl]propanoic acid.
| Compound Name | 3-[1-[(3-bromo-4-fluorophenyl)methyl]triazol-4-yl]propanoic acid |
|---|---|
| PubChem CID | 107460898 |
| Molecular Formula | C12H11BrFN3O2 |
| Molecular Weight | 328.14 g/mol |
| Exact Mass | 327.00 |
| IUPAC Name | 3-[1-[(3-bromo-4-fluorophenyl)methyl]triazol-4-yl]propanoic acid |
| SMILES | O=C(O)CCc1cn(Cc2ccc(F)c(Br)c2)nn1 |
| InChI | InChI=1S/C12H11BrFN3O2/c13-10-5-8(1-3-11(10)14)6-17-7-9(15-16-17)2-4-12(18)19/h1,3,5,7H,2,4,6H2,(H,18,19) |
| InChIKey | WMHQGDYLKYZLDK-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.14 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |