C11H9BrFN3O2 — CID 107460544
3-[1-(3-bromo-4-fluorophenyl)triazol-4-yl]propanoic acid (PubChem CID 107460544) has the molecular formula C11H9BrFN3O2 and a molecular weight of 314.11 g/mol. Its IUPAC name is 3-[1-(3-bromo-4-fluorophenyl)triazol-4-yl]propanoic acid.
| Compound Name | 3-[1-(3-bromo-4-fluorophenyl)triazol-4-yl]propanoic acid |
|---|---|
| PubChem CID | 107460544 |
| Molecular Formula | C11H9BrFN3O2 |
| Molecular Weight | 314.11 g/mol |
| Exact Mass | 312.99 |
| IUPAC Name | 3-[1-(3-bromo-4-fluorophenyl)triazol-4-yl]propanoic acid |
| SMILES | O=C(O)CCc1cn(-c2ccc(F)c(Br)c2)nn1 |
| InChI | InChI=1S/C11H9BrFN3O2/c12-9-5-8(2-3-10(9)13)16-6-7(14-15-16)1-4-11(17)18/h2-3,5-6H,1,4H2,(H,17,18) |
| InChIKey | VFIQWNAERVUHQF-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.11 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |