C12H12ClF2N3 — CID 113374613
4-(3-chloropropyl)-1-[(3,4-difluorophenyl)methyl]triazole (PubChem CID 113374613) has the molecular formula C12H12ClF2N3 and a molecular weight of 271.70 g/mol. Its IUPAC name is 4-(3-chloropropyl)-1-[(3,4-difluorophenyl)methyl]triazole.
| Compound Name | 4-(3-chloropropyl)-1-[(3,4-difluorophenyl)methyl]triazole |
|---|---|
| PubChem CID | 113374613 |
| Molecular Formula | C12H12ClF2N3 |
| Molecular Weight | 271.70 g/mol |
| Exact Mass | 271.07 |
| IUPAC Name | 4-(3-chloropropyl)-1-[(3,4-difluorophenyl)methyl]triazole |
| SMILES | Fc1ccc(Cn2cc(CCCCl)nn2)cc1F |
| InChI | InChI=1S/C12H12ClF2N3/c13-5-1-2-10-8-18(17-16-10)7-9-3-4-11(14)12(15)6-9/h3-4,6,8H,1-2,5,7H2 |
| InChIKey | XHWBGEWZYOAVLA-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.70 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|