C20H21N3O3 — CID 166385432
2-[4-[[4-(4-hydroxybutyl)triazol-1-yl]methyl]phenyl]benzoic acid (PubChem CID 166385432) has the molecular formula C20H21N3O3 and a molecular weight of 351.41 g/mol. Its IUPAC name is 2-[4-[[4-(4-hydroxybutyl)triazol-1-yl]methyl]phenyl]benzoic acid.
| Compound Name | 2-[4-[[4-(4-hydroxybutyl)triazol-1-yl]methyl]phenyl]benzoic acid |
|---|---|
| PubChem CID | 166385432 |
| Molecular Formula | C20H21N3O3 |
| Molecular Weight | 351.41 g/mol |
| Exact Mass | 351.16 |
| IUPAC Name | 2-[4-[[4-(4-hydroxybutyl)triazol-1-yl]methyl]phenyl]benzoic acid |
| SMILES | O=C(O)c1ccccc1-c1ccc(Cn2cc(CCCCO)nn2)cc1 |
| InChI | InChI=1S/C20H21N3O3/c24-12-4-3-5-17-14-23(22-21-17)13-15-8-10-16(11-9-15)18-6-1-2-7-19(18)20(25)26/h1-2,6-11,14,24H,3-5,12-13H2,(H,25,26) |
| InChIKey | HBRWBOGWXTWXOH-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 88.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.41 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|