C18H17N3O3 — CID 166385430
2-[4-[[4-(1-hydroxyethyl)triazol-1-yl]methyl]phenyl]benzoic acid (PubChem CID 166385430) has the molecular formula C18H17N3O3 and a molecular weight of 323.35 g/mol. Its IUPAC name is 2-[4-[[4-(1-hydroxyethyl)triazol-1-yl]methyl]phenyl]benzoic acid.
| Compound Name | 2-[4-[[4-(1-hydroxyethyl)triazol-1-yl]methyl]phenyl]benzoic acid |
|---|---|
| PubChem CID | 166385430 |
| Molecular Formula | C18H17N3O3 |
| Molecular Weight | 323.35 g/mol |
| Exact Mass | 323.13 |
| IUPAC Name | 2-[4-[[4-(1-hydroxyethyl)triazol-1-yl]methyl]phenyl]benzoic acid |
| SMILES | CC(O)c1cn(Cc2ccc(-c3ccccc3C(=O)O)cc2)nn1 |
| InChI | InChI=1S/C18H17N3O3/c1-12(22)17-11-21(20-19-17)10-13-6-8-14(9-7-13)15-4-2-3-5-16(15)18(23)24/h2-9,11-12,22H,10H2,1H3,(H,23,24) |
| InChIKey | HHIOUFKBVVDYGD-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 88.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.35 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |