C24H29N3O3 — CID 91262536
2-[4-[(5-oxo-1-pentyl-3-propan-2-yl-1,2,4-triazol-4-yl)methyl]phenyl]benzoic acid (PubChem CID 91262536) has the molecular formula C24H29N3O3 and a molecular weight of 407.51 g/mol. Its IUPAC name is 2-[4-[(5-oxo-1-pentyl-3-propan-2-yl-1,2,4-triazol-4-yl)methyl]phenyl]benzoic acid.
| Compound Name | 2-[4-[(5-oxo-1-pentyl-3-propan-2-yl-1,2,4-triazol-4-yl)methyl]phenyl]benzoic acid |
|---|---|
| PubChem CID | 91262536 |
| Molecular Formula | C24H29N3O3 |
| Molecular Weight | 407.51 g/mol |
| Exact Mass | 407.22 |
| IUPAC Name | 2-[4-[(5-oxo-1-pentyl-3-propan-2-yl-1,2,4-triazol-4-yl)methyl]phenyl]benzoic acid |
| SMILES | CCCCCn1nc(C(C)C)n(Cc2ccc(-c3ccccc3C(=O)O)cc2)c1=O |
| InChI | InChI=1S/C24H29N3O3/c1-4-5-8-15-27-24(30)26(22(25-27)17(2)3)16-18-11-13-19(14-12-18)20-9-6-7-10-21(20)23(28)29/h6-7,9-14,17H,4-5,8,15-16H2,1-3H3,(H,28,29) |
| InChIKey | LIMYHCZFLOMXHG-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 77.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.51 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|