C28H33N3O3 — CID 91395751
2-[4-[(3-but-1-ynyl-1-octyl-5-oxo-1,2,4-triazol-4-yl)methyl]phenyl]benzoic acid (PubChem CID 91395751) has the molecular formula C28H33N3O3 and a molecular weight of 459.59 g/mol. Its IUPAC name is 2-[4-[(3-but-1-ynyl-1-octyl-5-oxo-1,2,4-triazol-4-yl)methyl]phenyl]benzoic acid.
| Compound Name | 2-[4-[(3-but-1-ynyl-1-octyl-5-oxo-1,2,4-triazol-4-yl)methyl]phenyl]benzoic acid |
|---|---|
| PubChem CID | 91395751 |
| Molecular Formula | C28H33N3O3 |
| Molecular Weight | 459.59 g/mol |
| Exact Mass | 459.25 |
| IUPAC Name | 2-[4-[(3-but-1-ynyl-1-octyl-5-oxo-1,2,4-triazol-4-yl)methyl]phenyl]benzoic acid |
| SMILES | CCC#Cc1nn(CCCCCCCC)c(=O)n1Cc1ccc(-c2ccccc2C(=O)O)cc1 |
| InChI | InChI=1S/C28H33N3O3/c1-3-5-7-8-9-12-20-31-28(34)30(26(29-31)15-6-4-2)21-22-16-18-23(19-17-22)24-13-10-11-14-25(24)27(32)33/h10-11,13-14,16-19H,3-5,7-9,12,20-21H2,1-2H3,(H,32,33) |
| InChIKey | ZJBITKTVSKKVDZ-UHFFFAOYSA-N |
| XLogP | 5.58 |
| TPSA | 77.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.59 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|