C33H36N10 — CID 175127031
1-(1-benzyltriazol-4-yl)-N,N-bis[1-(1-benzyltriazol-4-yl)ethyl]ethanamine (PubChem CID 175127031) has the molecular formula C33H36N10 and a molecular weight of 572.72 g/mol. Its IUPAC name is 1-(1-benzyltriazol-4-yl)-N,N-bis[1-(1-benzyltriazol-4-yl)ethyl]ethanamine.
| Compound Name | 1-(1-benzyltriazol-4-yl)-N,N-bis[1-(1-benzyltriazol-4-yl)ethyl]ethanamine |
|---|---|
| PubChem CID | 175127031 |
| Molecular Formula | C33H36N10 |
| Molecular Weight | 572.72 g/mol |
| Exact Mass | 572.31 |
| IUPAC Name | 1-(1-benzyltriazol-4-yl)-N,N-bis[1-(1-benzyltriazol-4-yl)ethyl]ethanamine |
| SMILES | CC(c1cn(Cc2ccccc2)nn1)N(C(C)c1cn(Cc2ccccc2)nn1)C(C)c1cn(Cc2ccccc2)nn1 |
| InChI | InChI=1S/C33H36N10/c1-25(31-22-40(37-34-31)19-28-13-7-4-8-14-28)43(26(2)32-23-41(38-35-32)20-29-15-9-5-10-16-29)27(3)33-24-42(39-36-33)21-30-17-11-6-12-18-30/h4-18,22-27H,19-21H2,1-3H3 |
| InChIKey | ZBGWOQJFXJZEGV-UHFFFAOYSA-N |
| XLogP | 5.49 |
| TPSA | 95.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.72 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |