C21H28N6O4 — CID 159838182
5-(1-benzyltriazol-4-yl)pentanoic acid;5-(2H-triazol-4-yl)pentanoic acid (PubChem CID 159838182) has the molecular formula C21H28N6O4 and a molecular weight of 428.49 g/mol. Its IUPAC name is 5-(1-benzyltriazol-4-yl)pentanoic acid;5-(2H-triazol-4-yl)pentanoic acid.
| Compound Name | 5-(1-benzyltriazol-4-yl)pentanoic acid;5-(2H-triazol-4-yl)pentanoic acid |
|---|---|
| PubChem CID | 159838182 |
| Molecular Formula | C21H28N6O4 |
| Molecular Weight | 428.49 g/mol |
| Exact Mass | 428.22 |
| IUPAC Name | 5-(1-benzyltriazol-4-yl)pentanoic acid;5-(2H-triazol-4-yl)pentanoic acid |
| SMILES | O=C(O)CCCCc1cn(Cc2ccccc2)nn1.O=C(O)CCCCc1cn[nH]n1 |
| InChI | InChI=1S/C14H17N3O2.C7H11N3O2/c18-14(19)9-5-4-8-13-11-17(16-15-13)10-12-6-2-1-3-7-12;11-7(12)4-2-1-3-6-5-8-10-9-6/h1-3,6-7,11H,4-5,8-10H2,(H,18,19);5H,1-4H2,(H,11,12)(H,8,9,10) |
| InChIKey | NOIRHZHPZXVIIM-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 146.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.49 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|