5-[1-[(2,3-dichlorophenyl)methyl]triazol-4-yl]pentanoic acid

C14H15Cl2N3O2 — CID 107309540

IUPAC5-[1-[(2,3-dichlorophenyl)methyl]triazol-4-yl]pentanoic acid
SMILESO=C(O)CCCCc1cn(Cc2cccc(Cl)c2Cl)nn1
InChIInChI=1S/C14H15Cl2N3O2/c15-12-6-3-4-10(14(12)16)8-19-9-11(17-18-19)5-1-2-7-13(20)21/h3-4,6,9H,1-2,5,7-8H2,(H,20,21)
InChIKeyVFEGWBXWVJUGIY-UHFFFAOYSA-N
MW328.20 g/mol
LogP3.43
Rot. Bonds7

About 5-[1-[(2,3-dichlorophenyl)methyl]triazol-4-yl]pentanoic acid

5-[1-[(2,3-dichlorophenyl)methyl]triazol-4-yl]pentanoic acid (PubChem CID 107309540) has the molecular formula C14H15Cl2N3O2 and a molecular weight of 328.20 g/mol. Its IUPAC name is 5-[1-[(2,3-dichlorophenyl)methyl]triazol-4-yl]pentanoic acid.

Molecular Properties

Compound Name5-[1-[(2,3-dichlorophenyl)methyl]triazol-4-yl]pentanoic acid
PubChem CID107309540
Molecular FormulaC14H15Cl2N3O2
Molecular Weight328.20 g/mol
Exact Mass327.05
IUPAC Name5-[1-[(2,3-dichlorophenyl)methyl]triazol-4-yl]pentanoic acid
SMILESO=C(O)CCCCc1cn(Cc2cccc(Cl)c2Cl)nn1
InChIInChI=1S/C14H15Cl2N3O2/c15-12-6-3-4-10(14(12)16)8-19-9-11(17-18-19)5-1-2-7-13(20)21/h3-4,6,9H,1-2,5,7-8H2,(H,20,21)
InChIKeyVFEGWBXWVJUGIY-UHFFFAOYSA-N
XLogP3.43
TPSA68.01 Ų
H-Bond Donors1
H-Bond Acceptors4
Rotatable Bonds7
Heavy Atoms21
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500328.20
LogP ≤ 53.43
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}

Analyze 5-[1-[(2,3-dichlorophenyl)methyl]triazol-4-yl]pentanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 5-[1-[(2,3-dichlorophenyl)methyl]triazol-4-yl]pentanoic acid?
The IUPAC name of 5-[1-[(2,3-dichlorophenyl)methyl]triazol-4-yl]pentanoic acid (CID 107309540) is 5-[1-[(2,3-dichlorophenyl)methyl]triazol-4-yl]pentanoic acid.
What is the SMILES notation for 5-[1-[(2,3-dichlorophenyl)methyl]triazol-4-yl]pentanoic acid?
The canonical SMILES for 5-[1-[(2,3-dichlorophenyl)methyl]triazol-4-yl]pentanoic acid is O=C(O)CCCCc1cn(Cc2cccc(Cl)c2Cl)nn1.
What is the InChIKey of 5-[1-[(2,3-dichlorophenyl)methyl]triazol-4-yl]pentanoic acid?
The InChIKey is VFEGWBXWVJUGIY-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H15Cl2N3O2/c15-12-6-3-4-10(14(12)16)8-19-9-11(17-18-19)5-1-2-7-13(20)21/h3-4,6,9H,1-2,5,7-8H2,(H,20,21).
What are the key properties of 5-[1-[(2,3-dichlorophenyl)methyl]triazol-4-yl]pentanoic acid?
5-[1-[(2,3-dichlorophenyl)methyl]triazol-4-yl]pentanoic acid has a molecular weight of 328.20 g/mol, XLogP of 3.43, 7 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[1-[(2,3-dichlorophenyl)methyl]triazol-4-yl]pentanoic acid is sourced from PubChem (CID 107309540), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).