C13H18ClN5O2 — CID 104538802
5-[1-[(4-chloro-1,3-dimethylpyrazol-5-yl)methyl]triazol-4-yl]pentanoic acid (PubChem CID 104538802) has the molecular formula C13H18ClN5O2 and a molecular weight of 311.77 g/mol. Its IUPAC name is 5-[1-[(4-chloro-1,3-dimethylpyrazol-5-yl)methyl]triazol-4-yl]pentanoic acid.
| Compound Name | 5-[1-[(4-chloro-1,3-dimethylpyrazol-5-yl)methyl]triazol-4-yl]pentanoic acid |
|---|---|
| PubChem CID | 104538802 |
| Molecular Formula | C13H18ClN5O2 |
| Molecular Weight | 311.77 g/mol |
| Exact Mass | 311.11 |
| IUPAC Name | 5-[1-[(4-chloro-1,3-dimethylpyrazol-5-yl)methyl]triazol-4-yl]pentanoic acid |
| SMILES | Cc1nn(C)c(Cn2cc(CCCCC(=O)O)nn2)c1Cl |
| InChI | InChI=1S/C13H18ClN5O2/c1-9-13(14)11(18(2)16-9)8-19-7-10(15-17-19)5-3-4-6-12(20)21/h7H,3-6,8H2,1-2H3,(H,20,21) |
| InChIKey | JLQPQYGILPIJIH-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 85.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.77 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|