C12H19ClN6 — CID 104539356
4-[1-[(4-chloro-1,3-dimethylpyrazol-5-yl)methyl]triazol-4-yl]butan-1-amine (PubChem CID 104539356) has the molecular formula C12H19ClN6 and a molecular weight of 282.78 g/mol. Its IUPAC name is 4-[1-[(4-chloro-1,3-dimethylpyrazol-5-yl)methyl]triazol-4-yl]butan-1-amine.
| Compound Name | 4-[1-[(4-chloro-1,3-dimethylpyrazol-5-yl)methyl]triazol-4-yl]butan-1-amine |
|---|---|
| PubChem CID | 104539356 |
| Molecular Formula | C12H19ClN6 |
| Molecular Weight | 282.78 g/mol |
| Exact Mass | 282.14 |
| IUPAC Name | 4-[1-[(4-chloro-1,3-dimethylpyrazol-5-yl)methyl]triazol-4-yl]butan-1-amine |
| SMILES | Cc1nn(C)c(Cn2cc(CCCCN)nn2)c1Cl |
| InChI | InChI=1S/C12H19ClN6/c1-9-12(13)11(18(2)16-9)8-19-7-10(15-17-19)5-3-4-6-14/h7H,3-6,8,14H2,1-2H3 |
| InChIKey | UQHQCCVSJPSDMD-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 74.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.78 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|