C13H21ClN6 — CID 66194343
N-[[1-[(4-chloro-3-ethyl-1-methylpyrazol-5-yl)methyl]triazol-4-yl]methyl]propan-2-amine (PubChem CID 66194343) has the molecular formula C13H21ClN6 and a molecular weight of 296.81 g/mol. Its IUPAC name is N-[[1-[(4-chloro-3-ethyl-1-methylpyrazol-5-yl)methyl]triazol-4-yl]methyl]propan-2-amine.
| Compound Name | N-[[1-[(4-chloro-3-ethyl-1-methylpyrazol-5-yl)methyl]triazol-4-yl]methyl]propan-2-amine |
|---|---|
| PubChem CID | 66194343 |
| Molecular Formula | C13H21ClN6 |
| Molecular Weight | 296.81 g/mol |
| Exact Mass | 296.15 |
| IUPAC Name | N-[[1-[(4-chloro-3-ethyl-1-methylpyrazol-5-yl)methyl]triazol-4-yl]methyl]propan-2-amine |
| SMILES | CCc1nn(C)c(Cn2cc(CNC(C)C)nn2)c1Cl |
| InChI | InChI=1S/C13H21ClN6/c1-5-11-13(14)12(19(4)17-11)8-20-7-10(16-18-20)6-15-9(2)3/h7,9,15H,5-6,8H2,1-4H3 |
| InChIKey | MNYSWSMRYDLYKK-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 60.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.81 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |