C12H17N5O2 — CID 104538867
5-[1-[(3-methylimidazol-4-yl)methyl]triazol-4-yl]pentanoic acid (PubChem CID 104538867) has the molecular formula C12H17N5O2 and a molecular weight of 263.30 g/mol. Its IUPAC name is 5-[1-[(3-methylimidazol-4-yl)methyl]triazol-4-yl]pentanoic acid.
| Compound Name | 5-[1-[(3-methylimidazol-4-yl)methyl]triazol-4-yl]pentanoic acid |
|---|---|
| PubChem CID | 104538867 |
| Molecular Formula | C12H17N5O2 |
| Molecular Weight | 263.30 g/mol |
| Exact Mass | 263.14 |
| IUPAC Name | 5-[1-[(3-methylimidazol-4-yl)methyl]triazol-4-yl]pentanoic acid |
| SMILES | Cn1cncc1Cn1cc(CCCCC(=O)O)nn1 |
| InChI | InChI=1S/C12H17N5O2/c1-16-9-13-6-11(16)8-17-7-10(14-15-17)4-2-3-5-12(18)19/h6-7,9H,2-5,8H2,1H3,(H,18,19) |
| InChIKey | FQQISAAWEUKCAK-UHFFFAOYSA-N |
| XLogP | 0.86 |
| TPSA | 85.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.30 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|