C11H14N4O2S — CID 104538769
5-[1-(1,3-thiazol-2-ylmethyl)triazol-4-yl]pentanoic acid (PubChem CID 104538769) has the molecular formula C11H14N4O2S and a molecular weight of 266.33 g/mol. Its IUPAC name is 5-[1-(1,3-thiazol-2-ylmethyl)triazol-4-yl]pentanoic acid.
| Compound Name | 5-[1-(1,3-thiazol-2-ylmethyl)triazol-4-yl]pentanoic acid |
|---|---|
| PubChem CID | 104538769 |
| Molecular Formula | C11H14N4O2S |
| Molecular Weight | 266.33 g/mol |
| Exact Mass | 266.08 |
| IUPAC Name | 5-[1-(1,3-thiazol-2-ylmethyl)triazol-4-yl]pentanoic acid |
| SMILES | O=C(O)CCCCc1cn(Cc2nccs2)nn1 |
| InChI | InChI=1S/C11H14N4O2S/c16-11(17)4-2-1-3-9-7-15(14-13-9)8-10-12-5-6-18-10/h5-7H,1-4,8H2,(H,16,17) |
| InChIKey | RPFHYTCVZFSOSS-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 80.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.33 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|