C25H30FNO7S — CID 170165040
2-O-benzyl 1-O-tert-butyl (2S,4R)-4-fluoro-4-[(4-methylphenyl)sulfonyloxymethyl]pyrrolidine-1,2-dicarboxylate (PubChem CID 170165040) has the molecular formula C25H30FNO7S and a molecular weight of 507.58 g/mol. Its IUPAC name is 2-O-benzyl 1-O-tert-butyl (2S,4R)-4-fluoro-4-[(4-methylphenyl)sulfonyloxymethyl]pyrrolidine-1,2-dicarboxylate.
| Compound Name | 2-O-benzyl 1-O-tert-butyl (2S,4R)-4-fluoro-4-[(4-methylphenyl)sulfonyloxymethyl]pyrrolidine-1,2-dicarboxylate |
|---|---|
| PubChem CID | 170165040 |
| Molecular Formula | C25H30FNO7S |
| Molecular Weight | 507.58 g/mol |
| Exact Mass | 507.17 |
| IUPAC Name | 2-O-benzyl 1-O-tert-butyl (2S,4R)-4-fluoro-4-[(4-methylphenyl)sulfonyloxymethyl]pyrrolidine-1,2-dicarboxylate |
| SMILES | Cc1ccc(S(=O)(=O)OC[C@@]2(F)C[C@@H](C(=O)OCc3ccccc3)N(C(=O)OC(C)(C)C)C2)cc1 |
| InChI | InChI=1S/C25H30FNO7S/c1-18-10-12-20(13-11-18)35(30,31)33-17-25(26)14-21(27(16-25)23(29)34-24(2,3)4)22(28)32-15-19-8-6-5-7-9-19/h5-13,21H,14-17H2,1-4H3/t21-,25+/m0/s1 |
| InChIKey | ZEDCYSYKVHALKJ-SQJMNOBHSA-N |
| XLogP | 4.16 |
| TPSA | 99.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.58 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|