C25H29F2NO5S — CID 174985883
2-O-benzyl 1-O-tert-butyl (2S,4R)-4-fluoro-4-[(4-fluorophenoxy)methylsulfanylmethyl]pyrrolidine-1,2-dicarboxylate (PubChem CID 174985883) has the molecular formula C25H29F2NO5S and a molecular weight of 493.57 g/mol. Its IUPAC name is 2-O-benzyl 1-O-tert-butyl (2S,4R)-4-fluoro-4-[(4-fluorophenoxy)methylsulfanylmethyl]pyrrolidine-1,2-dicarboxylate.
| Compound Name | 2-O-benzyl 1-O-tert-butyl (2S,4R)-4-fluoro-4-[(4-fluorophenoxy)methylsulfanylmethyl]pyrrolidine-1,2-dicarboxylate |
|---|---|
| PubChem CID | 174985883 |
| Molecular Formula | C25H29F2NO5S |
| Molecular Weight | 493.57 g/mol |
| Exact Mass | 493.17 |
| IUPAC Name | 2-O-benzyl 1-O-tert-butyl (2S,4R)-4-fluoro-4-[(4-fluorophenoxy)methylsulfanylmethyl]pyrrolidine-1,2-dicarboxylate |
| SMILES | CC(C)(C)OC(=O)N1C[C@@](F)(CSCOc2ccc(F)cc2)C[C@H]1C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C25H29F2NO5S/c1-24(2,3)33-23(30)28-15-25(27,16-34-17-32-20-11-9-19(26)10-12-20)13-21(28)22(29)31-14-18-7-5-4-6-8-18/h4-12,21H,13-17H2,1-3H3/t21-,25+/m0/s1 |
| InChIKey | AOIGITIMPLDREC-SQJMNOBHSA-N |
| XLogP | 5.36 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.57 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|