C26H36FNO7 — CID 163226065
2-O-benzyl 1-O-tert-butyl (2S,4R)-4-[[(E)-6-ethoxy-6-oxohex-2-enoxy]methyl]-4-fluoropyrrolidine-1,2-dicarboxylate (PubChem CID 163226065) has the molecular formula C26H36FNO7 and a molecular weight of 493.57 g/mol. Its IUPAC name is 2-O-benzyl 1-O-tert-butyl (2S,4R)-4-[[(E)-6-ethoxy-6-oxohex-2-enoxy]methyl]-4-fluoropyrrolidine-1,2-dicarboxylate.
| Compound Name | 2-O-benzyl 1-O-tert-butyl (2S,4R)-4-[[(E)-6-ethoxy-6-oxohex-2-enoxy]methyl]-4-fluoropyrrolidine-1,2-dicarboxylate |
|---|---|
| PubChem CID | 163226065 |
| Molecular Formula | C26H36FNO7 |
| Molecular Weight | 493.57 g/mol |
| Exact Mass | 493.25 |
| IUPAC Name | 2-O-benzyl 1-O-tert-butyl (2S,4R)-4-[[(E)-6-ethoxy-6-oxohex-2-enoxy]methyl]-4-fluoropyrrolidine-1,2-dicarboxylate |
| SMILES | CCOC(=O)CC/C=C/COC[C@@]1(F)C[C@@H](C(=O)OCc2ccccc2)N(C(=O)OC(C)(C)C)C1 |
| InChI | InChI=1S/C26H36FNO7/c1-5-33-22(29)14-10-7-11-15-32-19-26(27)16-21(28(18-26)24(31)35-25(2,3)4)23(30)34-17-20-12-8-6-9-13-20/h6-9,11-13,21H,5,10,14-19H2,1-4H3/b11-7+/t21-,26+/m0/s1 |
| InChIKey | SRKDPULUAUHHAN-SZWIBNMXSA-N |
| XLogP | 4.36 |
| TPSA | 91.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.57 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|