C19H23N3O6 — CID 101015518
8-O-benzyl 7-O-tert-butyl (5R,8S)-2,4-dioxo-1,3,7-triazaspiro[4.4]nonane-7,8-dicarboxylate (PubChem CID 101015518) has the molecular formula C19H23N3O6 and a molecular weight of 389.41 g/mol. Its IUPAC name is 8-O-benzyl 7-O-tert-butyl (5R,8S)-2,4-dioxo-1,3,7-triazaspiro[4.4]nonane-7,8-dicarboxylate.
| Compound Name | 8-O-benzyl 7-O-tert-butyl (5R,8S)-2,4-dioxo-1,3,7-triazaspiro[4.4]nonane-7,8-dicarboxylate |
|---|---|
| PubChem CID | 101015518 |
| Molecular Formula | C19H23N3O6 |
| Molecular Weight | 389.41 g/mol |
| Exact Mass | 389.16 |
| IUPAC Name | 8-O-benzyl 7-O-tert-butyl (5R,8S)-2,4-dioxo-1,3,7-triazaspiro[4.4]nonane-7,8-dicarboxylate |
| SMILES | CC(C)(C)OC(=O)N1C[C@@]2(C[C@H]1C(=O)OCc1ccccc1)NC(=O)NC2=O |
| InChI | InChI=1S/C19H23N3O6/c1-18(2,3)28-17(26)22-11-19(15(24)20-16(25)21-19)9-13(22)14(23)27-10-12-7-5-4-6-8-12/h4-8,13H,9-11H2,1-3H3,(H2,20,21,24,25)/t13-,19+/m0/s1 |
| InChIKey | JSOSESAAIQCATM-ORAYPTAESA-N |
| XLogP | 1.32 |
| TPSA | 114.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.41 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|