C16H28FNO8S — CID 169197747
1-O-tert-butyl 2-O-ethyl (2S,4R)-4-fluoro-4-(2-methylsulfonyloxyethoxymethyl)pyrrolidine-1,2-dicarboxylate (PubChem CID 169197747) has the molecular formula C16H28FNO8S and a molecular weight of 413.46 g/mol. Its IUPAC name is 1-O-tert-butyl 2-O-ethyl (2S,4R)-4-fluoro-4-(2-methylsulfonyloxyethoxymethyl)pyrrolidine-1,2-dicarboxylate.
| Compound Name | 1-O-tert-butyl 2-O-ethyl (2S,4R)-4-fluoro-4-(2-methylsulfonyloxyethoxymethyl)pyrrolidine-1,2-dicarboxylate |
|---|---|
| PubChem CID | 169197747 |
| Molecular Formula | C16H28FNO8S |
| Molecular Weight | 413.46 g/mol |
| Exact Mass | 413.15 |
| IUPAC Name | 1-O-tert-butyl 2-O-ethyl (2S,4R)-4-fluoro-4-(2-methylsulfonyloxyethoxymethyl)pyrrolidine-1,2-dicarboxylate |
| SMILES | CCOC(=O)[C@@H]1C[C@](F)(COCCOS(C)(=O)=O)CN1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C16H28FNO8S/c1-6-24-13(19)12-9-16(17,11-23-7-8-25-27(5,21)22)10-18(12)14(20)26-15(2,3)4/h12H,6-11H2,1-5H3/t12-,16+/m0/s1 |
| InChIKey | RHUXPJVMFIKNPI-BLLLJJGKSA-N |
| XLogP | 1.26 |
| TPSA | 108.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.46 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|