C17H31FN2O4 — CID 126670857
2-O-butyl 1-O-tert-butyl (2S,4S)-4-[(dimethylamino)methyl]-4-fluoropyrrolidine-1,2-dicarboxylate (PubChem CID 126670857) has the molecular formula C17H31FN2O4 and a molecular weight of 346.44 g/mol. Its IUPAC name is 2-O-butyl 1-O-tert-butyl (2S,4S)-4-[(dimethylamino)methyl]-4-fluoropyrrolidine-1,2-dicarboxylate.
| Compound Name | 2-O-butyl 1-O-tert-butyl (2S,4S)-4-[(dimethylamino)methyl]-4-fluoropyrrolidine-1,2-dicarboxylate |
|---|---|
| PubChem CID | 126670857 |
| Molecular Formula | C17H31FN2O4 |
| Molecular Weight | 346.44 g/mol |
| Exact Mass | 346.23 |
| IUPAC Name | 2-O-butyl 1-O-tert-butyl (2S,4S)-4-[(dimethylamino)methyl]-4-fluoropyrrolidine-1,2-dicarboxylate |
| SMILES | CCCCOC(=O)[C@@H]1C[C@](F)(CN(C)C)CN1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C17H31FN2O4/c1-7-8-9-23-14(21)13-10-17(18,11-19(5)6)12-20(13)15(22)24-16(2,3)4/h13H,7-12H2,1-6H3/t13-,17-/m0/s1 |
| InChIKey | JWWFBANVMAVFPP-GUYCJALGSA-N |
| XLogP | 2.61 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.44 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|