C15H26FNO5 — CID 126670667
2-O-butyl 1-O-tert-butyl (2S)-4-[(1R)-1-fluoro-2-hydroxyethyl]azetidine-1,2-dicarboxylate (PubChem CID 126670667) has the molecular formula C15H26FNO5 and a molecular weight of 319.37 g/mol. Its IUPAC name is 2-O-butyl 1-O-tert-butyl (2S)-4-[(1R)-1-fluoro-2-hydroxyethyl]azetidine-1,2-dicarboxylate.
| Compound Name | 2-O-butyl 1-O-tert-butyl (2S)-4-[(1R)-1-fluoro-2-hydroxyethyl]azetidine-1,2-dicarboxylate |
|---|---|
| PubChem CID | 126670667 |
| Molecular Formula | C15H26FNO5 |
| Molecular Weight | 319.37 g/mol |
| Exact Mass | 319.18 |
| IUPAC Name | 2-O-butyl 1-O-tert-butyl (2S)-4-[(1R)-1-fluoro-2-hydroxyethyl]azetidine-1,2-dicarboxylate |
| SMILES | CCCCOC(=O)[C@@H]1CC([C@@H](F)CO)N1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C15H26FNO5/c1-5-6-7-21-13(19)12-8-11(10(16)9-18)17(12)14(20)22-15(2,3)4/h10-12,18H,5-9H2,1-4H3/t10-,11?,12-/m0/s1 |
| InChIKey | MQDFOOMMMILKSM-PRWSFJOGSA-N |
| XLogP | 2.04 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.37 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|