C16H27NO4 — CID 129090457
2-O-butyl 1-O-tert-butyl (2S)-5-ethenylpyrrolidine-1,2-dicarboxylate (PubChem CID 129090457) has the molecular formula C16H27NO4 and a molecular weight of 297.40 g/mol. Its IUPAC name is 2-O-butyl 1-O-tert-butyl (2S)-5-ethenylpyrrolidine-1,2-dicarboxylate.
| Compound Name | 2-O-butyl 1-O-tert-butyl (2S)-5-ethenylpyrrolidine-1,2-dicarboxylate |
|---|---|
| PubChem CID | 129090457 |
| Molecular Formula | C16H27NO4 |
| Molecular Weight | 297.40 g/mol |
| Exact Mass | 297.19 |
| IUPAC Name | 2-O-butyl 1-O-tert-butyl (2S)-5-ethenylpyrrolidine-1,2-dicarboxylate |
| SMILES | C=CC1CC[C@@H](C(=O)OCCCC)N1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C16H27NO4/c1-6-8-11-20-14(18)13-10-9-12(7-2)17(13)15(19)21-16(3,4)5/h7,12-13H,2,6,8-11H2,1,3-5H3/t12?,13-/m0/s1 |
| InChIKey | LZZFSQWJUWTLGX-ABLWVSNPSA-N |
| XLogP | 3.28 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.40 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|