C16H27NO5 — CID 155280476
tert-butyl (5S)-2-formyl-5-[2-[(2-methylpropan-2-yl)oxy]acetyl]pyrrolidine-1-carboxylate (PubChem CID 155280476) has the molecular formula C16H27NO5 and a molecular weight of 313.39 g/mol. Its IUPAC name is tert-butyl (5S)-2-formyl-5-[2-[(2-methylpropan-2-yl)oxy]acetyl]pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl (5S)-2-formyl-5-[2-[(2-methylpropan-2-yl)oxy]acetyl]pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 155280476 |
| Molecular Formula | C16H27NO5 |
| Molecular Weight | 313.39 g/mol |
| Exact Mass | 313.19 |
| IUPAC Name | tert-butyl (5S)-2-formyl-5-[2-[(2-methylpropan-2-yl)oxy]acetyl]pyrrolidine-1-carboxylate |
| SMILES | CC(C)(C)OCC(=O)[C@@H]1CCC(C=O)N1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C16H27NO5/c1-15(2,3)21-10-13(19)12-8-7-11(9-18)17(12)14(20)22-16(4,5)6/h9,11-12H,7-8,10H2,1-6H3/t11?,12-/m0/s1 |
| InChIKey | ZYKZZXBREWVHRE-KIYNQFGBSA-N |
| XLogP | 2.34 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.39 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|