C23H22O5S — CID 102157974
tert-butyl 2-[2-(4-methylphenyl)sulfonylethynyl]-3-oxo-1H-indene-2-carboxylate (PubChem CID 102157974) has the molecular formula C23H22O5S and a molecular weight of 410.49 g/mol. Its IUPAC name is tert-butyl 2-[2-(4-methylphenyl)sulfonylethynyl]-3-oxo-1H-indene-2-carboxylate.
| Compound Name | tert-butyl 2-[2-(4-methylphenyl)sulfonylethynyl]-3-oxo-1H-indene-2-carboxylate |
|---|---|
| PubChem CID | 102157974 |
| Molecular Formula | C23H22O5S |
| Molecular Weight | 410.49 g/mol |
| Exact Mass | 410.12 |
| IUPAC Name | tert-butyl 2-[2-(4-methylphenyl)sulfonylethynyl]-3-oxo-1H-indene-2-carboxylate |
| SMILES | Cc1ccc(S(=O)(=O)C#CC2(C(=O)OC(C)(C)C)Cc3ccccc3C2=O)cc1 |
| InChI | InChI=1S/C23H22O5S/c1-16-9-11-18(12-10-16)29(26,27)14-13-23(21(25)28-22(2,3)4)15-17-7-5-6-8-19(17)20(23)24/h5-12H,15H2,1-4H3 |
| InChIKey | JNOFJNQMTFRWNW-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 77.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.49 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_3', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|