C24H26O5S — CID 16658429
tert-butyl (2R)-2-[(E)-4-(benzenesulfonyl)but-2-enyl]-3-oxo-1H-indene-2-carboxylate (PubChem CID 16658429) has the molecular formula C24H26O5S and a molecular weight of 426.53 g/mol. Its IUPAC name is tert-butyl (2R)-2-[(E)-4-(benzenesulfonyl)but-2-enyl]-3-oxo-1H-indene-2-carboxylate.
| Compound Name | tert-butyl (2R)-2-[(E)-4-(benzenesulfonyl)but-2-enyl]-3-oxo-1H-indene-2-carboxylate |
|---|---|
| PubChem CID | 16658429 |
| Molecular Formula | C24H26O5S |
| Molecular Weight | 426.53 g/mol |
| Exact Mass | 426.15 |
| IUPAC Name | tert-butyl (2R)-2-[(E)-4-(benzenesulfonyl)but-2-enyl]-3-oxo-1H-indene-2-carboxylate |
| SMILES | CC(C)(C)OC(=O)[C@]1(C/C=C/CS(=O)(=O)c2ccccc2)Cc2ccccc2C1=O |
| InChI | InChI=1S/C24H26O5S/c1-23(2,3)29-22(26)24(17-18-11-7-8-14-20(18)21(24)25)15-9-10-16-30(27,28)19-12-5-4-6-13-19/h4-14H,15-17H2,1-3H3/b10-9+/t24-/m1/s1 |
| InChIKey | FHRWWRQFZBLYRP-HBRDYDSTSA-N |
| XLogP | 4.17 |
| TPSA | 77.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.53 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|