C25H27NO4 — CID 138981235
tert-butyl (3R)-1-benzyl-2,5-dioxo-3-[(E)-3-phenylprop-2-enyl]pyrrolidine-3-carboxylate (PubChem CID 138981235) has the molecular formula C25H27NO4 and a molecular weight of 405.49 g/mol. Its IUPAC name is tert-butyl (3R)-1-benzyl-2,5-dioxo-3-[(E)-3-phenylprop-2-enyl]pyrrolidine-3-carboxylate.
| Compound Name | tert-butyl (3R)-1-benzyl-2,5-dioxo-3-[(E)-3-phenylprop-2-enyl]pyrrolidine-3-carboxylate |
|---|---|
| PubChem CID | 138981235 |
| Molecular Formula | C25H27NO4 |
| Molecular Weight | 405.49 g/mol |
| Exact Mass | 405.19 |
| IUPAC Name | tert-butyl (3R)-1-benzyl-2,5-dioxo-3-[(E)-3-phenylprop-2-enyl]pyrrolidine-3-carboxylate |
| SMILES | CC(C)(C)OC(=O)[C@]1(C/C=C/c2ccccc2)CC(=O)N(Cc2ccccc2)C1=O |
| InChI | InChI=1S/C25H27NO4/c1-24(2,3)30-23(29)25(16-10-15-19-11-6-4-7-12-19)17-21(27)26(22(25)28)18-20-13-8-5-9-14-20/h4-15H,16-18H2,1-3H3/b15-10+/t25-/m1/s1 |
| InChIKey | GLCUHUQYQPYTEX-ZFBAEGHFSA-N |
| XLogP | 4.38 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.49 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|