C19H25NO4 — CID 163690850
tert-butyl (3R)-3-ethyl-4,5-dioxo-1-[(1R)-1-phenylethyl]pyrrolidine-3-carboxylate (PubChem CID 163690850) has the molecular formula C19H25NO4 and a molecular weight of 331.41 g/mol. Its IUPAC name is tert-butyl (3R)-3-ethyl-4,5-dioxo-1-[(1R)-1-phenylethyl]pyrrolidine-3-carboxylate.
| Compound Name | tert-butyl (3R)-3-ethyl-4,5-dioxo-1-[(1R)-1-phenylethyl]pyrrolidine-3-carboxylate |
|---|---|
| PubChem CID | 163690850 |
| Molecular Formula | C19H25NO4 |
| Molecular Weight | 331.41 g/mol |
| Exact Mass | 331.18 |
| IUPAC Name | tert-butyl (3R)-3-ethyl-4,5-dioxo-1-[(1R)-1-phenylethyl]pyrrolidine-3-carboxylate |
| SMILES | CC[C@@]1(C(=O)OC(C)(C)C)CN([C@H](C)c2ccccc2)C(=O)C1=O |
| InChI | InChI=1S/C19H25NO4/c1-6-19(17(23)24-18(3,4)5)12-20(16(22)15(19)21)13(2)14-10-8-7-9-11-14/h7-11,13H,6,12H2,1-5H3/t13-,19-/m1/s1 |
| InChIKey | JSWBQLOTYODTSZ-BFUOFWGJSA-N |
| XLogP | 2.90 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.41 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|