C25H28O2 — CID 102600152
(2R)-2-acetyl-2-[(E)-3-(4-tert-butylphenyl)prop-2-enyl]-3,4-dihydronaphthalen-1-one (PubChem CID 102600152) has the molecular formula C25H28O2 and a molecular weight of 360.50 g/mol. Its IUPAC name is (2R)-2-acetyl-2-[(E)-3-(4-tert-butylphenyl)prop-2-enyl]-3,4-dihydronaphthalen-1-one.
| Compound Name | (2R)-2-acetyl-2-[(E)-3-(4-tert-butylphenyl)prop-2-enyl]-3,4-dihydronaphthalen-1-one |
|---|---|
| PubChem CID | 102600152 |
| Molecular Formula | C25H28O2 |
| Molecular Weight | 360.50 g/mol |
| Exact Mass | 360.21 |
| IUPAC Name | (2R)-2-acetyl-2-[(E)-3-(4-tert-butylphenyl)prop-2-enyl]-3,4-dihydronaphthalen-1-one |
| SMILES | CC(=O)[C@]1(C/C=C/c2ccc(C(C)(C)C)cc2)CCc2ccccc2C1=O |
| InChI | InChI=1S/C25H28O2/c1-18(26)25(17-15-20-9-5-6-10-22(20)23(25)27)16-7-8-19-11-13-21(14-12-19)24(2,3)4/h5-14H,15-17H2,1-4H3/b8-7+/t25-/m0/s1 |
| InChIKey | PATJFIINFKERQQ-NJFIGMEYSA-N |
| XLogP | 5.79 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.50 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|