C20H20O3 — CID 12858249
ethyl 2-benzyl-1-oxo-3,4-dihydronaphthalene-2-carboxylate (PubChem CID 12858249) has the molecular formula C20H20O3 and a molecular weight of 308.38 g/mol. Its IUPAC name is ethyl 2-benzyl-1-oxo-3,4-dihydronaphthalene-2-carboxylate.
| Compound Name | ethyl 2-benzyl-1-oxo-3,4-dihydronaphthalene-2-carboxylate |
|---|---|
| PubChem CID | 12858249 |
| Molecular Formula | C20H20O3 |
| Molecular Weight | 308.38 g/mol |
| Exact Mass | 308.14 |
| IUPAC Name | ethyl 2-benzyl-1-oxo-3,4-dihydronaphthalene-2-carboxylate |
| SMILES | CCOC(=O)C1(Cc2ccccc2)CCc2ccccc2C1=O |
| InChI | InChI=1S/C20H20O3/c1-2-23-19(22)20(14-15-8-4-3-5-9-15)13-12-16-10-6-7-11-17(16)18(20)21/h3-11H,2,12-14H2,1H3 |
| InChIKey | GUVZJWOQYKSOPX-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.38 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|