C15H19NO2S — CID 10755015
ethyl (3R)-3-benzyl-2-sulfanylidenepiperidine-3-carboxylate (PubChem CID 10755015) has the molecular formula C15H19NO2S and a molecular weight of 277.39 g/mol. Its IUPAC name is ethyl (3R)-3-benzyl-2-sulfanylidenepiperidine-3-carboxylate.
| Compound Name | ethyl (3R)-3-benzyl-2-sulfanylidenepiperidine-3-carboxylate |
|---|---|
| PubChem CID | 10755015 |
| Molecular Formula | C15H19NO2S |
| Molecular Weight | 277.39 g/mol |
| Exact Mass | 277.11 |
| IUPAC Name | ethyl (3R)-3-benzyl-2-sulfanylidenepiperidine-3-carboxylate |
| SMILES | CCOC(=O)[C@]1(Cc2ccccc2)CCCNC1=S |
| InChI | InChI=1S/C15H19NO2S/c1-2-18-14(17)15(9-6-10-16-13(15)19)11-12-7-4-3-5-8-12/h3-5,7-8H,2,6,9-11H2,1H3,(H,16,19)/t15-/m0/s1 |
| InChIKey | JMTBVMDGKHZMSU-HNNXBMFYSA-N |
| XLogP | 2.49 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.39 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|