About diethyl 2-benzylpiperidine-3,3-dicarboxylate;hydrochloride
diethyl 2-benzylpiperidine-3,3-dicarboxylate;hydrochloride (PubChem CID 21436195) has the molecular formula C18H26ClNO4
and a molecular weight of 355.86 g/mol. Its IUPAC name is diethyl 2-benzylpiperidine-3,3-dicarboxylate;hydrochloride.
Molecular Properties
| Compound Name | diethyl 2-benzylpiperidine-3,3-dicarboxylate;hydrochloride |
| PubChem CID | 21436195 |
| Molecular Formula | C18H26ClNO4 |
| Molecular Weight | 355.86 g/mol |
| Exact Mass | 355.16 |
| IUPAC Name | diethyl 2-benzylpiperidine-3,3-dicarboxylate;hydrochloride |
| SMILES | CCOC(=O)C1(C(=O)OCC)CCCNC1Cc1ccccc1.Cl |
| InChI | InChI=1S/C18H25NO4.ClH/c1-3-22-16(20)18(17(21)23-4-2)11-8-12-19-15(18)13-14-9-6-5-7-10-14;/h5-7,9-10,15,19H,3-4,8,11-13H2,1-2H3;1H |
| InChIKey | LLDKWYHTYNKOEQ-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 355.86 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze diethyl 2-benzylpiperidine-3,3-dicarboxylate;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of diethyl 2-benzylpiperidine-3,3-dicarboxylate;hydrochloride?
The IUPAC name of diethyl 2-benzylpiperidine-3,3-dicarboxylate;hydrochloride (CID 21436195) is diethyl 2-benzylpiperidine-3,3-dicarboxylate;hydrochloride.
What is the SMILES notation for diethyl 2-benzylpiperidine-3,3-dicarboxylate;hydrochloride?
The canonical SMILES for diethyl 2-benzylpiperidine-3,3-dicarboxylate;hydrochloride is CCOC(=O)C1(C(=O)OCC)CCCNC1Cc1ccccc1.Cl.
What is the InChIKey of diethyl 2-benzylpiperidine-3,3-dicarboxylate;hydrochloride?
The InChIKey is LLDKWYHTYNKOEQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H25NO4.ClH/c1-3-22-16(20)18(17(21)23-4-2)11-8-12-19-15(18)13-14-9-6-5-7-10-14;/h5-7,9-10,15,19H,3-4,8,11-13H2,1-2H3;1H.
What are the key properties of diethyl 2-benzylpiperidine-3,3-dicarboxylate;hydrochloride?
diethyl 2-benzylpiperidine-3,3-dicarboxylate;hydrochloride has a molecular weight of 355.86 g/mol, XLogP of 2.52, 6 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for diethyl 2-benzylpiperidine-3,3-dicarboxylate;hydrochloride is sourced from PubChem (CID 21436195), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).