C19H28ClNO5 — CID 21436300
diethyl 2-[(4-methoxyphenyl)methyl]piperidine-3,3-dicarboxylate;hydrochloride (PubChem CID 21436300) has the molecular formula C19H28ClNO5 and a molecular weight of 385.89 g/mol. Its IUPAC name is diethyl 2-[(4-methoxyphenyl)methyl]piperidine-3,3-dicarboxylate;hydrochloride.
| Compound Name | diethyl 2-[(4-methoxyphenyl)methyl]piperidine-3,3-dicarboxylate;hydrochloride |
|---|---|
| PubChem CID | 21436300 |
| Molecular Formula | C19H28ClNO5 |
| Molecular Weight | 385.89 g/mol |
| Exact Mass | 385.17 |
| IUPAC Name | diethyl 2-[(4-methoxyphenyl)methyl]piperidine-3,3-dicarboxylate;hydrochloride |
| SMILES | CCOC(=O)C1(C(=O)OCC)CCCNC1Cc1ccc(OC)cc1.Cl |
| InChI | InChI=1S/C19H27NO5.ClH/c1-4-24-17(21)19(18(22)25-5-2)11-6-12-20-16(19)13-14-7-9-15(23-3)10-8-14;/h7-10,16,20H,4-6,11-13H2,1-3H3;1H |
| InChIKey | ABDLPRLXSKSXNI-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.89 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|