C16H24ClNO3 — CID 112758018
ethyl 2-[(3-methoxyphenyl)methyl]piperidine-2-carboxylate;hydrochloride (PubChem CID 112758018) has the molecular formula C16H24ClNO3 and a molecular weight of 313.82 g/mol. Its IUPAC name is ethyl 2-[(3-methoxyphenyl)methyl]piperidine-2-carboxylate;hydrochloride.
| Compound Name | ethyl 2-[(3-methoxyphenyl)methyl]piperidine-2-carboxylate;hydrochloride |
|---|---|
| PubChem CID | 112758018 |
| Molecular Formula | C16H24ClNO3 |
| Molecular Weight | 313.82 g/mol |
| Exact Mass | 313.14 |
| IUPAC Name | ethyl 2-[(3-methoxyphenyl)methyl]piperidine-2-carboxylate;hydrochloride |
| SMILES | CCOC(=O)C1(Cc2cccc(OC)c2)CCCCN1.Cl |
| InChI | InChI=1S/C16H23NO3.ClH/c1-3-20-15(18)16(9-4-5-10-17-16)12-13-7-6-8-14(11-13)19-2;/h6-8,11,17H,3-5,9-10,12H2,1-2H3;1H |
| InChIKey | IXFSVPMCMOHMCC-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.82 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |