C19H24O2 — CID 101254429
(2S)-2-acetyl-2-[(E)-3-phenylprop-2-enyl]cyclooctan-1-one (PubChem CID 101254429) has the molecular formula C19H24O2 and a molecular weight of 284.40 g/mol. Its IUPAC name is (2S)-2-acetyl-2-[(E)-3-phenylprop-2-enyl]cyclooctan-1-one.
| Compound Name | (2S)-2-acetyl-2-[(E)-3-phenylprop-2-enyl]cyclooctan-1-one |
|---|---|
| PubChem CID | 101254429 |
| Molecular Formula | C19H24O2 |
| Molecular Weight | 284.40 g/mol |
| Exact Mass | 284.18 |
| IUPAC Name | (2S)-2-acetyl-2-[(E)-3-phenylprop-2-enyl]cyclooctan-1-one |
| SMILES | CC(=O)[C@@]1(C/C=C/c2ccccc2)CCCCCCC1=O |
| InChI | InChI=1S/C19H24O2/c1-16(20)19(14-8-3-2-7-13-18(19)21)15-9-12-17-10-5-4-6-11-17/h4-6,9-12H,2-3,7-8,13-15H2,1H3/b12-9+/t19-/m0/s1 |
| InChIKey | MEVVTWYIAPYAMD-DLENHJPASA-N |
| XLogP | 4.59 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.40 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|