C22H21NO4 — CID 138595276
(3S)-1-benzoyl-2-oxo-3-(3-phenylprop-2-enyl)piperidine-3-carboxylic acid (PubChem CID 138595276) has the molecular formula C22H21NO4 and a molecular weight of 363.41 g/mol. Its IUPAC name is (3S)-1-benzoyl-2-oxo-3-(3-phenylprop-2-enyl)piperidine-3-carboxylic acid.
| Compound Name | (3S)-1-benzoyl-2-oxo-3-(3-phenylprop-2-enyl)piperidine-3-carboxylic acid |
|---|---|
| PubChem CID | 138595276 |
| Molecular Formula | C22H21NO4 |
| Molecular Weight | 363.41 g/mol |
| Exact Mass | 363.15 |
| IUPAC Name | (3S)-1-benzoyl-2-oxo-3-(3-phenylprop-2-enyl)piperidine-3-carboxylic acid |
| SMILES | O=C(c1ccccc1)N1CCC[C@@](CC=Cc2ccccc2)(C(=O)O)C1=O |
| InChI | InChI=1S/C22H21NO4/c24-19(18-12-5-2-6-13-18)23-16-8-15-22(20(23)25,21(26)27)14-7-11-17-9-3-1-4-10-17/h1-7,9-13H,8,14-16H2,(H,26,27)/t22-/m1/s1 |
| InChIKey | ZBBVXECUGVKMGU-JOCHJYFZSA-N |
| XLogP | 3.62 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.41 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|